About 2,2-diphenylacetaldehyde
2,2-diphenylacetaldehyde (PubChem CID 13696) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,2-diphenylacetaldehyde.
Molecular Properties
| Compound Name | 2,2-diphenylacetaldehyde |
| PubChem CID | 13696 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2,2-diphenylacetaldehyde |
| SMILES | O=CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,14H |
| InChIKey | HLLGFGBLKOIZOM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenylacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenylacetaldehyde?
The IUPAC name of 2,2-diphenylacetaldehyde (CID 13696) is 2,2-diphenylacetaldehyde.
What is the SMILES notation for 2,2-diphenylacetaldehyde?
The canonical SMILES for 2,2-diphenylacetaldehyde is O=CC(c1ccccc1)c1ccccc1.
What is the InChIKey of 2,2-diphenylacetaldehyde?
The InChIKey is HLLGFGBLKOIZOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,14H.
What are the key properties of 2,2-diphenylacetaldehyde?
2,2-diphenylacetaldehyde has a molecular weight of 196.25 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenylacetaldehyde is sourced from PubChem (CID 13696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).