C12H12N4OS — CID 136960117
3-amino-7-propan-2-yl-8H-[1,2]thiazolo[5,4-f]quinazolin-9-one (PubChem CID 136960117) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-amino-7-propan-2-yl-8H-[1,2]thiazolo[5,4-f]quinazolin-9-one.
| Compound Name | 3-amino-7-propan-2-yl-8H-[1,2]thiazolo[5,4-f]quinazolin-9-one |
|---|---|
| PubChem CID | 136960117 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-amino-7-propan-2-yl-8H-[1,2]thiazolo[5,4-f]quinazolin-9-one |
| SMILES | CC(C)c1nc2ccc3c(N)nsc3c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H12N4OS/c1-5(2)11-14-7-4-3-6-9(18-16-10(6)13)8(7)12(17)15-11/h3-5H,1-2H3,(H2,13,16)(H,14,15,17) |
| InChIKey | KQOGZGIOANEGKI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |