C26H23N3O3S — CID 136961387
(5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-2-(4-phenoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136961387) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-2-(4-phenoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-2-(4-phenoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136961387 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (5E)-5-[(4-morpholin-4-ylphenyl)methylidene]-2-(4-phenoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(Oc3ccccc3)cc2)S/C1=C/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H23N3O3S/c30-25-24(18-19-6-10-21(11-7-19)29-14-16-31-17-15-29)33-26(28-25)27-20-8-12-23(13-9-20)32-22-4-2-1-3-5-22/h1-13,18H,14-17H2,(H,27,28,30)/b24-18+ |
| InChIKey | QULJPDCSSCOAQA-HKOYGPOVSA-N |
| XLogP | 5.21 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|