About 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol
4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol (PubChem CID 136961393) has the molecular formula C10H12N6O
and a molecular weight of 232.25 g/mol. Its IUPAC name is 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol.
Molecular Properties
| Compound Name | 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol |
| PubChem CID | 136961393 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol |
| SMILES | Cn1nc(N)c(/N=N/c2ccc(O)cc2)c1N |
| InChI | InChI=1S/C10H12N6O/c1-16-10(12)8(9(11)15-16)14-13-6-2-4-7(17)5-3-6/h2-5,17H,12H2,1H3,(H2,11,15)/b14-13+ |
| InChIKey | SIRSCBHJSFPOKE-BUHFOSPRSA-N |
| XLogP | 1.71 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol?
The IUPAC name of 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol (CID 136961393) is 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol.
What is the SMILES notation for 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol?
The canonical SMILES for 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol is Cn1nc(N)c(/N=N/c2ccc(O)cc2)c1N.
What is the InChIKey of 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol?
The InChIKey is SIRSCBHJSFPOKE-BUHFOSPRSA-N. The full InChI is InChI=1S/C10H12N6O/c1-16-10(12)8(9(11)15-16)14-13-6-2-4-7(17)5-3-6/h2-5,17H,12H2,1H3,(H2,11,15)/b14-13+.
What are the key properties of 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol?
4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol has a molecular weight of 232.25 g/mol, XLogP of 1.71, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-diamino-1-methylpyrazol-4-yl)diazenyl]phenol is sourced from PubChem (CID 136961393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).