About (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one
(3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one (PubChem CID 136961565) has the molecular formula C21H18ClN3O4
and a molecular weight of 411.85 g/mol. Its IUPAC name is (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one.
Molecular Properties
| Compound Name | (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one |
| PubChem CID | 136961565 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one |
| SMILES | COc1cc(-c2cc(/C=C3\C(=O)Nc4cc(Cl)ccc43)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H18ClN3O4/c1-27-18-6-11(7-19(28-2)20(18)29-3)16-10-13(24-25-16)9-15-14-5-4-12(22)8-17(14)23-21(15)26/h4-10H,1-3H3,(H,23,26)(H,24,25)/b15-9- |
| InChIKey | MPLUMBRBQZTMJL-DHDCSXOGSA-N |
| XLogP | 4.25 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one?
The IUPAC name of (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one (CID 136961565) is (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one.
What is the SMILES notation for (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one?
The canonical SMILES for (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one is COc1cc(-c2cc(/C=C3\C(=O)Nc4cc(Cl)ccc43)[nH]n2)cc(OC)c1OC.
What is the InChIKey of (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one?
The InChIKey is MPLUMBRBQZTMJL-DHDCSXOGSA-N. The full InChI is InChI=1S/C21H18ClN3O4/c1-27-18-6-11(7-19(28-2)20(18)29-3)16-10-13(24-25-16)9-15-14-5-4-12(22)8-17(14)23-21(15)26/h4-10H,1-3H3,(H,23,26)(H,24,25)/b15-9-.
What are the key properties of (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one?
(3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one has a molecular weight of 411.85 g/mol, XLogP of 4.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-chloro-3-[[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]methylidene]-1H-indol-2-one is sourced from PubChem (CID 136961565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).