About 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid
2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid (PubChem CID 136961587) has the molecular formula C16H11ClN2O5
and a molecular weight of 346.73 g/mol. Its IUPAC name is 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid |
| PubChem CID | 136961587 |
| Molecular Formula | C16H11ClN2O5 |
| Molecular Weight | 346.73 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(-c2ccc(O)cc2O)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H11ClN2O5/c17-8-1-4-12-11(5-8)18-15(16(24)19(12)7-14(22)23)10-3-2-9(20)6-13(10)21/h1-6,20-21H,7H2,(H,22,23) |
| InChIKey | ZCSRKPJQPOJUQO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid?
The IUPAC name of 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid (CID 136961587) is 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid.
What is the SMILES notation for 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid?
The canonical SMILES for 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid is O=C(O)Cn1c(=O)c(-c2ccc(O)cc2O)nc2cc(Cl)ccc21.
What is the InChIKey of 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid?
The InChIKey is ZCSRKPJQPOJUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O5/c17-8-1-4-12-11(5-8)18-15(16(24)19(12)7-14(22)23)10-3-2-9(20)6-13(10)21/h1-6,20-21H,7H2,(H,22,23).
What are the key properties of 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid?
2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid has a molecular weight of 346.73 g/mol, XLogP of 2.21, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-chloro-3-(2,4-dihydroxyphenyl)-2-oxoquinoxalin-1-yl]acetic acid is sourced from PubChem (CID 136961587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).