C13H18N4O — CID 136961774
2-cyclopropyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one (PubChem CID 136961774) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-cyclopropyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136961774 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-cyclopropyl-4-(1,2,3,6-tetrahydropyridin-4-ylmethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC2=CCNCC2)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C13H18N4O/c18-12-7-11(16-13(17-12)10-1-2-10)15-8-9-3-5-14-6-4-9/h3,7,10,14H,1-2,4-6,8H2,(H2,15,16,17,18) |
| InChIKey | XHPRARHOOUKBAL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|