About 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine
2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine (PubChem CID 136961848) has the molecular formula C15H15ClN4
and a molecular weight of 286.77 g/mol. Its IUPAC name is 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine.
Molecular Properties
| Compound Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine |
| PubChem CID | 136961848 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine |
| SMILES | NCC/N=C1\Nc2cc(Cl)ccc2Nc2ccccc21 |
| InChI | InChI=1S/C15H15ClN4/c16-10-5-6-13-14(9-10)20-15(18-8-7-17)11-3-1-2-4-12(11)19-13/h1-6,9,19H,7-8,17H2,(H,18,20) |
| InChIKey | WNEOPUAIBRLQMV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine?
The IUPAC name of 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine (CID 136961848) is 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine.
What is the SMILES notation for 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine?
The canonical SMILES for 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine is NCC/N=C1\Nc2cc(Cl)ccc2Nc2ccccc21.
What is the InChIKey of 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine?
The InChIKey is WNEOPUAIBRLQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4/c16-10-5-6-13-14(9-10)20-15(18-8-7-17)11-3-1-2-4-12(11)19-13/h1-6,9,19H,7-8,17H2,(H,18,20).
What are the key properties of 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine?
2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine has a molecular weight of 286.77 g/mol, XLogP of 3.21, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-ylidene)amino]ethanamine is sourced from PubChem (CID 136961848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).