C20H37N7O — CID 136962319
2-[6-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)hexyl]-1-prop-2-ynylguanidine (PubChem CID 136962319) has the molecular formula C20H37N7O and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-[6-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)hexyl]-1-prop-2-ynylguanidine.
| Compound Name | 2-[6-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)hexyl]-1-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 136962319 |
| Molecular Formula | C20H37N7O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 2-[6-(4-amino-2-oxo-1,3,5-triazacyclotridec-4-en-1-yl)hexyl]-1-prop-2-ynylguanidine |
| SMILES | C#CCN/C(N)=N/CCCCCCN1CCCCCCCC/N=C(/N)NC1=O |
| InChI | InChI=1S/C20H37N7O/c1-2-13-23-18(21)24-14-10-6-8-12-17-27-16-11-7-4-3-5-9-15-25-19(22)26-20(27)28/h1H,3-17H2,(H3,21,23,24)(H3,22,25,26,28) |
| InChIKey | MEWLYRCWBOTUEL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|