C14H18N2 — CID 136962819
N-methyl-2,3,4,8a,10,10a-hexahydro-1H-acridin-9-imine (PubChem CID 136962819) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-methyl-2,3,4,8a,10,10a-hexahydro-1H-acridin-9-imine.
| Compound Name | N-methyl-2,3,4,8a,10,10a-hexahydro-1H-acridin-9-imine |
|---|---|
| PubChem CID | 136962819 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | N-methyl-2,3,4,8a,10,10a-hexahydro-1H-acridin-9-imine |
| SMILES | C/N=C1/C2=C(CCCC2)NC2C=CC=CC12 |
| InChI | InChI=1S/C14H18N2/c1-15-14-10-6-2-4-8-12(10)16-13-9-5-3-7-11(13)14/h2,4,6,8,10,12,16H,3,5,7,9H2,1H3/b15-14+ |
| InChIKey | NNFPQDVLLISRQA-CCEZHUSRSA-N |
| XLogP | 2.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|