C19H16F6N6O2 — CID 136962928
6-[4-[(4R,5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 136962928) has the molecular formula C19H16F6N6O2 and a molecular weight of 474.37 g/mol. Its IUPAC name is 6-[4-[(4R,5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-[4-[(4R,5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 136962928 |
| Molecular Formula | C19H16F6N6O2 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 6-[4-[(4R,5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N2CCC(c3[nH]nc4c3[C@@H](C(F)(F)F)[C@@H](O)C(=O)N4)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F6N6O2/c20-18(21,22)10-5-11(27-7-9(10)6-26)31-3-1-8(2-4-31)14-12-13(19(23,24)25)15(32)17(33)28-16(12)30-29-14/h5,7-8,13,15,32H,1-4H2,(H2,28,29,30,33)/t13-,15-/m1/s1 |
| InChIKey | DPTFXICMQHYXLC-UKRRQHHQSA-N |
| XLogP | 3.04 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |