C26H23F6N5O4 — CID 136962940
benzyl 2-[4-[(5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-5-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 136962940) has the molecular formula C26H23F6N5O4 and a molecular weight of 583.49 g/mol. Its IUPAC name is benzyl 2-[4-[(5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-5-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | benzyl 2-[4-[(5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-5-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 136962940 |
| Molecular Formula | C26H23F6N5O4 |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | benzyl 2-[4-[(5R)-5-hydroxy-6-oxo-4-(trifluoromethyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridin-3-yl]piperidin-1-yl]-5-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc(N2CCC(c3[nH]nc4c3C(C(F)(F)F)[C@@H](O)C(=O)N4)CC2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H23F6N5O4/c27-25(28,29)16-11-33-17(10-15(16)24(40)41-12-13-4-2-1-3-5-13)37-8-6-14(7-9-37)20-18-19(26(30,31)32)21(38)23(39)34-22(18)36-35-20/h1-5,10-11,14,19,21,38H,6-9,12H2,(H2,34,35,36,39)/t19?,21-/m1/s1 |
| InChIKey | QJPHSSYPHHHALA-VGAJERRHSA-N |
| XLogP | 4.52 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |