C19H15ClN6 — CID 136963109
5-[(3-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 136963109) has the molecular formula C19H15ClN6 and a molecular weight of 362.82 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 5-[(3-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 136963109 |
| Molecular Formula | C19H15ClN6 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)-12-methyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | Cc1nnc2ccc3c(cc(-c4cnc[nH]4)n3Cc3cccc(Cl)c3)n12 |
| InChI | InChI=1S/C19H15ClN6/c1-12-23-24-19-6-5-16-18(26(12)19)8-17(15-9-21-11-22-15)25(16)10-13-3-2-4-14(20)7-13/h2-9,11H,10H2,1H3,(H,21,22) |
| InChIKey | CAOFFYXVDJRZEG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |