C10H7F3N2O3 — CID 136963417
3-(5-amino-1,2-oxazol-3-yl)-6-(trifluoromethyl)benzene-1,2-diol (PubChem CID 136963417) has the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-3-yl)-6-(trifluoromethyl)benzene-1,2-diol.
| Compound Name | 3-(5-amino-1,2-oxazol-3-yl)-6-(trifluoromethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 136963417 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-3-yl)-6-(trifluoromethyl)benzene-1,2-diol |
| SMILES | Nc1cc(-c2ccc(C(F)(F)F)c(O)c2O)no1 |
| InChI | InChI=1S/C10H7F3N2O3/c11-10(12,13)5-2-1-4(8(16)9(5)17)6-3-7(14)18-15-6/h1-3,16-17H,14H2 |
| InChIKey | BNRWZARLMXDXNC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|