C15H23IN2O2 — CID 136963971
2-(1-ethoxy-4-methylcyclohexyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one (PubChem CID 136963971) has the molecular formula C15H23IN2O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-(1-ethoxy-4-methylcyclohexyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(1-ethoxy-4-methylcyclohexyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136963971 |
| Molecular Formula | C15H23IN2O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-(1-ethoxy-4-methylcyclohexyl)-4-ethyl-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCOC1(c2nc(CC)c(I)c(=O)[nH]2)CCC(C)CC1 |
| InChI | InChI=1S/C15H23IN2O2/c1-4-11-12(16)13(19)18-14(17-11)15(20-5-2)8-6-10(3)7-9-15/h10H,4-9H2,1-3H3,(H,17,18,19) |
| InChIKey | PXESREOLEYZRNO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|