C11H10BrClN2OS — CID 136964601
2-(4-bromo-5-chlorothiophen-2-yl)-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136964601) has the molecular formula C11H10BrClN2OS and a molecular weight of 333.64 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136964601 |
| Molecular Formula | C11H10BrClN2OS |
| Molecular Weight | 333.64 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1cc(=O)[nH]c(-c2cc(Br)c(Cl)s2)n1 |
| InChI | InChI=1S/C11H10BrClN2OS/c1-5(2)7-4-9(16)15-11(14-7)8-3-6(12)10(13)17-8/h3-5H,1-2H3,(H,14,15,16) |
| InChIKey | GCUAVBAJZDKVOT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |