C27H36N4O5 — CID 136964669
2-[4-[(2E)-2-[(Z)-3-(cyclopropylmethoxy)prop-1-enyl]penta-2,4-dienoyl]piperidin-1-yl]-N-[(4-oxo-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-2-yl)methyl]acetamide (PubChem CID 136964669) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[(Z)-3-(cyclopropylmethoxy)prop-1-enyl]penta-2,4-dienoyl]piperidin-1-yl]-N-[(4-oxo-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-2-yl)methyl]acetamide.
| Compound Name | 2-[4-[(2E)-2-[(Z)-3-(cyclopropylmethoxy)prop-1-enyl]penta-2,4-dienoyl]piperidin-1-yl]-N-[(4-oxo-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 136964669 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-[4-[(2E)-2-[(Z)-3-(cyclopropylmethoxy)prop-1-enyl]penta-2,4-dienoyl]piperidin-1-yl]-N-[(4-oxo-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-2-yl)methyl]acetamide |
| SMILES | C=C/C=C(\C=C/COCC1CC1)C(=O)C1CCN(CC(=O)NCc2nc3c(c(=O)[nH]2)COCC3)CC1 |
| InChI | InChI=1S/C27H36N4O5/c1-2-4-20(5-3-13-35-17-19-6-7-19)26(33)21-8-11-31(12-9-21)16-25(32)28-15-24-29-23-10-14-36-18-22(23)27(34)30-24/h2-5,19,21H,1,6-18H2,(H,28,32)(H,29,30,34)/b5-3-,20-4+ |
| InChIKey | VMEYMUHYXHQNCA-FSQYMNRGSA-N |
| XLogP | 1.84 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|