C19H15ClF3N3O3 — CID 136964788
6-[2-chloro-6-(3-hydroxypropoxy)phenyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one (PubChem CID 136964788) has the molecular formula C19H15ClF3N3O3 and a molecular weight of 425.79 g/mol. Its IUPAC name is 6-[2-chloro-6-(3-hydroxypropoxy)phenyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one.
| Compound Name | 6-[2-chloro-6-(3-hydroxypropoxy)phenyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 136964788 |
| Molecular Formula | C19H15ClF3N3O3 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 6-[2-chloro-6-(3-hydroxypropoxy)phenyl]-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2ccc(C(F)(F)F)cc2)nc(-c2c(Cl)cccc2OCCCO)[nH]1 |
| InChI | InChI=1S/C19H15ClF3N3O3/c20-13-3-1-4-14(29-10-2-9-27)15(13)17-24-16(25-18(28)26-17)11-5-7-12(8-6-11)19(21,22)23/h1,3-8,27H,2,9-10H2,(H,24,25,26,28) |
| InChIKey | YHMYOTFSXOFOBP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|