C20H17ClF3N3O2 — CID 136964798
6-(2-butoxy-6-chlorophenyl)-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one (PubChem CID 136964798) has the molecular formula C20H17ClF3N3O2 and a molecular weight of 423.82 g/mol. Its IUPAC name is 6-(2-butoxy-6-chlorophenyl)-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(2-butoxy-6-chlorophenyl)-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 136964798 |
| Molecular Formula | C20H17ClF3N3O2 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 6-(2-butoxy-6-chlorophenyl)-4-[4-(trifluoromethyl)phenyl]-1H-1,3,5-triazin-2-one |
| SMILES | CCCCOc1cccc(Cl)c1-c1nc(-c2ccc(C(F)(F)F)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C20H17ClF3N3O2/c1-2-3-11-29-15-6-4-5-14(21)16(15)18-25-17(26-19(28)27-18)12-7-9-13(10-8-12)20(22,23)24/h4-10H,2-3,11H2,1H3,(H,25,26,27,28) |
| InChIKey | PCTURGOPILPODF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|