C8H15N3O2 — CID 136965370
3-(1-ethoxybutyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136965370) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-(1-ethoxybutyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(1-ethoxybutyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136965370 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-(1-ethoxybutyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCCC(OCC)c1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H15N3O2/c1-3-5-6(13-4-2)7-9-8(12)11-10-7/h6H,3-5H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | QZXBZQAKZLQRIC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |