C16H18N4O — CID 136965872
2-(2,3-dihydroindol-1-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one (PubChem CID 136965872) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one |
|---|---|
| PubChem CID | 136965872 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-3,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-4-one |
| SMILES | O=c1[nH]c(N2CCc3ccccc32)nc2c1CCNCC2 |
| InChI | InChI=1S/C16H18N4O/c21-15-12-5-8-17-9-6-13(12)18-16(19-15)20-10-7-11-3-1-2-4-14(11)20/h1-4,17H,5-10H2,(H,18,19,21) |
| InChIKey | PNRFDXJBNUEUDA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |