C25H23FN6O4 — CID 136966784
(E)-N-[14-amino-15-(2-fluoro-5-hydroxyphenyl)-12-oxo-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 136966784) has the molecular formula C25H23FN6O4 and a molecular weight of 490.50 g/mol. Its IUPAC name is (E)-N-[14-amino-15-(2-fluoro-5-hydroxyphenyl)-12-oxo-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[14-amino-15-(2-fluoro-5-hydroxyphenyl)-12-oxo-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 136966784 |
| Molecular Formula | C25H23FN6O4 |
| Molecular Weight | 490.50 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (E)-N-[14-amino-15-(2-fluoro-5-hydroxyphenyl)-12-oxo-9-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc2c1COc1[nH]c(=O)c3c(N)n(-c4cc(O)ccc4F)nc3c1-2 |
| InChI | InChI=1S/C25H23FN6O4/c1-31(2)10-4-7-19(34)28-17-6-3-5-14-15(17)12-36-25-20(14)22-21(24(35)29-25)23(27)32(30-22)18-11-13(33)8-9-16(18)26/h3-9,11,33H,10,12,27H2,1-2H3,(H,28,34)(H,29,35)/b7-4+ |
| InChIKey | TVDXYUNRACEIRO-QPJJXVBHSA-N |
| XLogP | 2.76 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|