C20H17N5O3 — CID 136966790
6,14-diamino-15-(5-hydroxy-2-methylphenyl)-8-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-12-one (PubChem CID 136966790) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 6,14-diamino-15-(5-hydroxy-2-methylphenyl)-8-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-12-one.
| Compound Name | 6,14-diamino-15-(5-hydroxy-2-methylphenyl)-8-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-12-one |
|---|---|
| PubChem CID | 136966790 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6,14-diamino-15-(5-hydroxy-2-methylphenyl)-8-oxa-11,15,16-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2(7),3,5,13,16-hexaen-12-one |
| SMILES | Cc1ccc(O)cc1-n1nc2c3c([nH]c(=O)c2c1N)COc1c(N)cccc1-3 |
| InChI | InChI=1S/C20H17N5O3/c1-9-5-6-10(26)7-14(9)25-19(22)16-17(24-25)15-11-3-2-4-12(21)18(11)28-8-13(15)23-20(16)27/h2-7,26H,8,21-22H2,1H3,(H,23,27) |
| InChIKey | BHJUWPXVOZXFTK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|