C10H17N5O2 — CID 136967479
2-amino-6-(1-hydroxybutyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 136967479) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-amino-6-(1-hydroxybutyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-(1-hydroxybutyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 136967479 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-amino-6-(1-hydroxybutyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CCCC(O)C1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C10H17N5O2/c1-2-3-6(16)5-4-12-8-7(13-5)9(17)15-10(11)14-8/h5-6,13,16H,2-4H2,1H3,(H4,11,12,14,15,17) |
| InChIKey | ABZFXDKIWHQNKL-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |