C22H21N5O — CID 136967774
(NZ)-N-[1-[6-[1-(6-propan-2-yl-2-pyridinyl)indazol-6-yl]-2-pyridinyl]ethylidene]hydroxylamine (PubChem CID 136967774) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is (NZ)-N-[1-[6-[1-(6-propan-2-yl-2-pyridinyl)indazol-6-yl]-2-pyridinyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[6-[1-(6-propan-2-yl-2-pyridinyl)indazol-6-yl]-2-pyridinyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 136967774 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (NZ)-N-[1-[6-[1-(6-propan-2-yl-2-pyridinyl)indazol-6-yl]-2-pyridinyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1cccc(-c2ccc3cnn(-c4cccc(C(C)C)n4)c3c2)n1 |
| InChI | InChI=1S/C22H21N5O/c1-14(2)18-6-5-9-22(25-18)27-21-12-16(10-11-17(21)13-23-27)20-8-4-7-19(24-20)15(3)26-28/h4-14,28H,1-3H3/b26-15- |
| InChIKey | ZIBCFFDUWRORQM-YSMPRRRNSA-N |
| XLogP | 4.80 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|