C9H11F4N3O2 — CID 136967808
4-amino-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one (PubChem CID 136967808) has the molecular formula C9H11F4N3O2 and a molecular weight of 269.20 g/mol. Its IUPAC name is 4-amino-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-amino-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136967808 |
| Molecular Formula | C9H11F4N3O2 |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-amino-5-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1c(N)nc(COCC(F)(F)C(F)F)[nH]c1=O |
| InChI | InChI=1S/C9H11F4N3O2/c1-4-6(14)15-5(16-7(4)17)2-18-3-9(12,13)8(10)11/h8H,2-3H2,1H3,(H3,14,15,16,17) |
| InChIKey | GINVUOGGQVHSME-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|