About 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid
5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid (PubChem CID 136968295) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid |
| PubChem CID | 136968295 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid |
| SMILES | CN1CCCc2c1ccc(-c1cc(C(=O)O)nn1C)c2O |
| InChI | InChI=1S/C15H17N3O3/c1-17-7-3-4-9-12(17)6-5-10(14(9)19)13-8-11(15(20)21)16-18(13)2/h5-6,8,19H,3-4,7H2,1-2H3,(H,20,21) |
| InChIKey | AKCKLDVZMVMWEC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The IUPAC name of 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid (CID 136968295) is 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid is CN1CCCc2c1ccc(-c1cc(C(=O)O)nn1C)c2O.
What is the InChIKey of 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid?
The InChIKey is AKCKLDVZMVMWEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-17-7-3-4-9-12(17)6-5-10(14(9)19)13-8-11(15(20)21)16-18(13)2/h5-6,8,19H,3-4,7H2,1-2H3,(H,20,21).
What are the key properties of 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid?
5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid has a molecular weight of 287.32 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-hydroxy-1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 136968295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).