C54H42N4 — CID 136969055
1-[4-(6-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-9-[3-(9,9-dimethylfluoren-4-yl)phenyl]carbazole (PubChem CID 136969055) has the molecular formula C54H42N4 and a molecular weight of 746.96 g/mol. Its IUPAC name is 1-[4-(6-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-9-[3-(9,9-dimethylfluoren-4-yl)phenyl]carbazole.
| Compound Name | 1-[4-(6-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-9-[3-(9,9-dimethylfluoren-4-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 136969055 |
| Molecular Formula | C54H42N4 |
| Molecular Weight | 746.96 g/mol |
| Exact Mass | 746.34 |
| IUPAC Name | 1-[4-(6-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-9-[3-(9,9-dimethylfluoren-4-yl)phenyl]carbazole |
| SMILES | CC1(C)c2ccccc2-c2c(-c3cccc(-n4c5ccccc5c5cccc(-c6ccc(C7N=C(c8ccccc8)N=C(C8=CC=CCC8)N7)cc6)c54)c3)cccc21 |
| InChI | InChI=1S/C54H42N4/c1-54(2)46-27-11-9-23-45(46)49-41(24-15-28-47(49)54)39-20-13-21-40(34-39)58-48-29-12-10-22-43(48)44-26-14-25-42(50(44)58)35-30-32-38(33-31-35)53-56-51(36-16-5-3-6-17-36)55-52(57-53)37-18-7-4-8-19-37/h3-7,9-18,20-34,53H,8,19H2,1-2H3,(H,55,56,57) |
| InChIKey | NUISEYHDAVISGG-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.96 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |