About 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one
1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136969913) has the molecular formula C16H16F3N5O
and a molecular weight of 351.33 g/mol. Its IUPAC name is 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 136969913 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)n1ncc2c(=O)[nH]c(NCc3ccc(C(F)(F)F)cc3)nc21 |
| InChI | InChI=1S/C16H16F3N5O/c1-9(2)24-13-12(8-21-24)14(25)23-15(22-13)20-7-10-3-5-11(6-4-10)16(17,18)19/h3-6,8-9H,7H2,1-2H3,(H2,20,22,23,25) |
| InChIKey | FYNNKYGMJUAQBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one (CID 136969913) is 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one is CC(C)n1ncc2c(=O)[nH]c(NCc3ccc(C(F)(F)F)cc3)nc21.
What is the InChIKey of 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is FYNNKYGMJUAQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3N5O/c1-9(2)24-13-12(8-21-24)14(25)23-15(22-13)20-7-10-3-5-11(6-4-10)16(17,18)19/h3-6,8-9H,7H2,1-2H3,(H2,20,22,23,25).
What are the key properties of 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one?
1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 351.33 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-6-[[4-(trifluoromethyl)phenyl]methylamino]-5H-pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 136969913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).