About 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile
2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile (PubChem CID 136969987) has the molecular formula C8H5N3O
and a molecular weight of 159.15 g/mol. Its IUPAC name is 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile |
| PubChem CID | 136969987 |
| Molecular Formula | C8H5N3O |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(O)[nH]c2cnccc12 |
| InChI | InChI=1S/C8H5N3O/c9-3-6-5-1-2-10-4-7(5)11-8(6)12/h1-2,4,11-12H |
| InChIKey | BQFRLGDMIYYYQD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile?
The IUPAC name of 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile (CID 136969987) is 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile.
What is the SMILES notation for 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile?
The canonical SMILES for 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile is N#Cc1c(O)[nH]c2cnccc12.
What is the InChIKey of 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile?
The InChIKey is BQFRLGDMIYYYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O/c9-3-6-5-1-2-10-4-7(5)11-8(6)12/h1-2,4,11-12H.
What are the key properties of 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile?
2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 1.14, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1H-pyrrolo[2,3-c]pyridine-3-carbonitrile is sourced from PubChem (CID 136969987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).