C8H6FN3O2 — CID 136969997
6-fluoro-N'-hydroxy-1,2-benzoxazole-3-carboximidamide (PubChem CID 136969997) has the molecular formula C8H6FN3O2 and a molecular weight of 195.15 g/mol. Its IUPAC name is 6-fluoro-N'-hydroxy-1,2-benzoxazole-3-carboximidamide.
| Compound Name | 6-fluoro-N'-hydroxy-1,2-benzoxazole-3-carboximidamide |
|---|---|
| PubChem CID | 136969997 |
| Molecular Formula | C8H6FN3O2 |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 6-fluoro-N'-hydroxy-1,2-benzoxazole-3-carboximidamide |
| SMILES | N/C(=N\O)c1noc2cc(F)ccc12 |
| InChI | InChI=1S/C8H6FN3O2/c9-4-1-2-5-6(3-4)14-12-7(5)8(10)11-13/h1-3,13H,(H2,10,11) |
| InChIKey | WAQMHKRETZDKMV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|