C27H29F6N7O2 — CID 136970069
(2S)-5-(5-oxo-1H-tetrazol-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-[1-(7,7,7-trifluoroheptyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one (PubChem CID 136970069) has the molecular formula C27H29F6N7O2 and a molecular weight of 597.56 g/mol. Its IUPAC name is (2S)-5-(5-oxo-1H-tetrazol-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-[1-(7,7,7-trifluoroheptyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-5-(5-oxo-1H-tetrazol-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-[1-(7,7,7-trifluoroheptyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 136970069 |
| Molecular Formula | C27H29F6N7O2 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | (2S)-5-(5-oxo-1H-tetrazol-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-2-[1-(7,7,7-trifluoroheptyl)pyrazol-4-yl]-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
| SMILES | O=C1N[C@@](c2cnn(CCCCCCC(F)(F)F)c2)(C(F)(F)F)CC(c2ccc3c(c2)CCCC3)=C1n1nn[nH]c1=O |
| InChI | InChI=1S/C27H29F6N7O2/c28-26(29,30)11-5-1-2-6-12-39-16-20(15-34-39)25(27(31,32)33)14-21(19-10-9-17-7-3-4-8-18(17)13-19)22(23(41)35-25)40-24(42)36-37-38-40/h9-10,13,15-16H,1-8,11-12,14H2,(H,35,41)(H,36,38,42)/t25-/m0/s1 |
| InChIKey | FCGICIUXXYBWOA-VWLOTQADSA-N |
| XLogP | 4.90 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|