C21H21N5O2 — CID 136970117
(2S,6R)-11-(4-phenoxyphenyl)-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-10-carboxamide (PubChem CID 136970117) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is (2S,6R)-11-(4-phenoxyphenyl)-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-10-carboxamide.
| Compound Name | (2S,6R)-11-(4-phenoxyphenyl)-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-10-carboxamide |
|---|---|
| PubChem CID | 136970117 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2S,6R)-11-(4-phenoxyphenyl)-1,4,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene-10-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nn2c1NC[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C21H21N5O2/c22-20(27)18-19(25-26-17-12-23-10-14(17)11-24-21(18)26)13-6-8-16(9-7-13)28-15-4-2-1-3-5-15/h1-9,14,17,23-24H,10-12H2,(H2,22,27)/t14-,17-/m1/s1 |
| InChIKey | YCABORKUSAHGNH-RHSMWYFYSA-N |
| XLogP | 2.63 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |