C30H33N5O3 — CID 136970123
(7S)-7-(1-hex-2-ynoylpiperidin-4-yl)-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136970123) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is (7S)-7-(1-hex-2-ynoylpiperidin-4-yl)-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (7S)-7-(1-hex-2-ynoylpiperidin-4-yl)-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136970123 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | (7S)-7-(1-hex-2-ynoylpiperidin-4-yl)-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCC#CC(=O)N1CCC([C@@H]2CCNc3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)nn32)CC1 |
| InChI | InChI=1S/C30H33N5O3/c1-2-3-5-10-26(36)34-19-16-21(17-20-34)25-15-18-32-30-27(29(31)37)28(33-35(25)30)22-11-13-24(14-12-22)38-23-8-6-4-7-9-23/h4,6-9,11-14,21,25,32H,2-3,15-20H2,1H3,(H2,31,37)/t25-/m0/s1 |
| InChIKey | ARLRKFFHPFWZFR-VWLOTQADSA-N |
| XLogP | 4.84 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|