About 5-fluoro-N-methyl-1,3-diazinan-2-imine
5-fluoro-N-methyl-1,3-diazinan-2-imine (PubChem CID 136970355) has the molecular formula C5H10FN3
and a molecular weight of 131.15 g/mol. Its IUPAC name is 5-fluoro-N-methyl-1,3-diazinan-2-imine.
Molecular Properties
| Compound Name | 5-fluoro-N-methyl-1,3-diazinan-2-imine |
| PubChem CID | 136970355 |
| Molecular Formula | C5H10FN3 |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 5-fluoro-N-methyl-1,3-diazinan-2-imine |
| SMILES | CN=C1NCC(F)CN1 |
| InChI | InChI=1S/C5H10FN3/c1-7-5-8-2-4(6)3-9-5/h4H,2-3H2,1H3,(H2,7,8,9) |
| InChIKey | FKOAPBNGEFSZNX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-N-methyl-1,3-diazinan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-methyl-1,3-diazinan-2-imine?
The IUPAC name of 5-fluoro-N-methyl-1,3-diazinan-2-imine (CID 136970355) is 5-fluoro-N-methyl-1,3-diazinan-2-imine.
What is the SMILES notation for 5-fluoro-N-methyl-1,3-diazinan-2-imine?
The canonical SMILES for 5-fluoro-N-methyl-1,3-diazinan-2-imine is CN=C1NCC(F)CN1.
What is the InChIKey of 5-fluoro-N-methyl-1,3-diazinan-2-imine?
The InChIKey is FKOAPBNGEFSZNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FN3/c1-7-5-8-2-4(6)3-9-5/h4H,2-3H2,1H3,(H2,7,8,9).
What are the key properties of 5-fluoro-N-methyl-1,3-diazinan-2-imine?
5-fluoro-N-methyl-1,3-diazinan-2-imine has a molecular weight of 131.15 g/mol, XLogP of -0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-methyl-1,3-diazinan-2-imine is sourced from PubChem (CID 136970355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).