C9H12ClN3OS — CID 136970759
5-chloro-4-[methyl(thiolan-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136970759) has the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. Its IUPAC name is 5-chloro-4-[methyl(thiolan-3-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[methyl(thiolan-3-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970759 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-chloro-4-[methyl(thiolan-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CN(c1nc[nH]c(=O)c1Cl)C1CCSC1 |
| InChI | InChI=1S/C9H12ClN3OS/c1-13(6-2-3-15-4-6)8-7(10)9(14)12-5-11-8/h5-6H,2-4H2,1H3,(H,11,12,14) |
| InChIKey | ICDQSMKZRRLGNA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |