C9H12IN3OS — CID 136970987
5-iodo-4-(1,4-thiazepan-4-yl)-1H-pyrimidin-6-one (PubChem CID 136970987) has the molecular formula C9H12IN3OS and a molecular weight of 337.19 g/mol. Its IUPAC name is 5-iodo-4-(1,4-thiazepan-4-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(1,4-thiazepan-4-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136970987 |
| Molecular Formula | C9H12IN3OS |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 5-iodo-4-(1,4-thiazepan-4-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCCSCC2)c1I |
| InChI | InChI=1S/C9H12IN3OS/c10-7-8(11-6-12-9(7)14)13-2-1-4-15-5-3-13/h6H,1-5H2,(H,11,12,14) |
| InChIKey | YBQVBEIIWNSZDY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|