C12H20BrN3O — CID 136971093
5-bromo-4-[pentyl(propan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136971093) has the molecular formula C12H20BrN3O and a molecular weight of 302.22 g/mol. Its IUPAC name is 5-bromo-4-[pentyl(propan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[pentyl(propan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971093 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-bromo-4-[pentyl(propan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CCCCCN(c1nc[nH]c(=O)c1Br)C(C)C |
| InChI | InChI=1S/C12H20BrN3O/c1-4-5-6-7-16(9(2)3)11-10(13)12(17)15-8-14-11/h8-9H,4-7H2,1-3H3,(H,14,15,17) |
| InChIKey | QPJKFDVOZUZPRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|