C11H14ClN3O2 — CID 136971148
4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-chloro-1H-pyrimidin-6-one (PubChem CID 136971148) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971148 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-5-chloro-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCOC3CCCC32)c1Cl |
| InChI | InChI=1S/C11H14ClN3O2/c12-9-10(13-6-14-11(9)16)15-4-5-17-8-3-1-2-7(8)15/h6-8H,1-5H2,(H,13,14,16) |
| InChIKey | YKBPGUUGCPMEAM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |