C8H10ClN5O3 — CID 136971259
2-[(2-amino-2-oxoethyl)-(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetamide (PubChem CID 136971259) has the molecular formula C8H10ClN5O3 and a molecular weight of 259.65 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 136971259 |
| Molecular Formula | C8H10ClN5O3 |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)c1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H10ClN5O3/c9-6-7(12-3-13-8(6)17)14(1-4(10)15)2-5(11)16/h3H,1-2H2,(H2,10,15)(H2,11,16)(H,12,13,17) |
| InChIKey | GWORMIKIEKFJRB-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |