C12H14IN3OS — CID 136971411
5-iodo-4-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136971411) has the molecular formula C12H14IN3OS and a molecular weight of 375.24 g/mol. Its IUPAC name is 5-iodo-4-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971411 |
| Molecular Formula | C12H14IN3OS |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 5-iodo-4-[methyl(1-thiophen-2-ylpropan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(Cc1cccs1)N(C)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C12H14IN3OS/c1-8(6-9-4-3-5-18-9)16(2)11-10(13)12(17)15-7-14-11/h3-5,7-8H,6H2,1-2H3,(H,14,15,17) |
| InChIKey | UGHMZGILZRHQMK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|