C9H10N6O3S — CID 136971745
N'-hydroxy-1-(3-methylsulfonyl-2-pyridinyl)-1,2,4-triazole-3-carboximidamide (PubChem CID 136971745) has the molecular formula C9H10N6O3S and a molecular weight of 282.29 g/mol. Its IUPAC name is N'-hydroxy-1-(3-methylsulfonyl-2-pyridinyl)-1,2,4-triazole-3-carboximidamide.
| Compound Name | N'-hydroxy-1-(3-methylsulfonyl-2-pyridinyl)-1,2,4-triazole-3-carboximidamide |
|---|---|
| PubChem CID | 136971745 |
| Molecular Formula | C9H10N6O3S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N'-hydroxy-1-(3-methylsulfonyl-2-pyridinyl)-1,2,4-triazole-3-carboximidamide |
| SMILES | CS(=O)(=O)c1cccnc1-n1cnc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C9H10N6O3S/c1-19(17,18)6-3-2-4-11-9(6)15-5-12-8(13-15)7(10)14-16/h2-5,16H,1H3,(H2,10,14) |
| InChIKey | UNFRYCIMZVRQDA-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|