C9H13BrClN3O2 — CID 136971828
5-bromo-4-[(2-chloro-3-methoxypropyl)-methylamino]-1H-pyrimidin-6-one (PubChem CID 136971828) has the molecular formula C9H13BrClN3O2 and a molecular weight of 310.58 g/mol. Its IUPAC name is 5-bromo-4-[(2-chloro-3-methoxypropyl)-methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-[(2-chloro-3-methoxypropyl)-methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971828 |
| Molecular Formula | C9H13BrClN3O2 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 5-bromo-4-[(2-chloro-3-methoxypropyl)-methylamino]-1H-pyrimidin-6-one |
| SMILES | COCC(Cl)CN(C)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C9H13BrClN3O2/c1-14(3-6(11)4-16-2)8-7(10)9(15)13-5-12-8/h5-6H,3-4H2,1-2H3,(H,12,13,15) |
| InChIKey | YJYIDGRLPXEODV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|