C9H11BrIN3O — CID 136971976
4-[2-(bromomethyl)pyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136971976) has the molecular formula C9H11BrIN3O and a molecular weight of 384.02 g/mol. Its IUPAC name is 4-[2-(bromomethyl)pyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(bromomethyl)pyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136971976 |
| Molecular Formula | C9H11BrIN3O |
| Molecular Weight | 384.02 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 4-[2-(bromomethyl)pyrrolidin-1-yl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCCC2CBr)c1I |
| InChI | InChI=1S/C9H11BrIN3O/c10-4-6-2-1-3-14(6)8-7(11)9(15)13-5-12-8/h5-6H,1-4H2,(H,12,13,15) |
| InChIKey | VFSFYEWHNNXZAH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.02 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|