C13H22BrN5O — CID 136972674
4-[4-(5-aminopentyl)piperazin-1-yl]-5-bromo-1H-pyrimidin-6-one (PubChem CID 136972674) has the molecular formula C13H22BrN5O and a molecular weight of 344.26 g/mol. Its IUPAC name is 4-[4-(5-aminopentyl)piperazin-1-yl]-5-bromo-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(5-aminopentyl)piperazin-1-yl]-5-bromo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136972674 |
| Molecular Formula | C13H22BrN5O |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[4-(5-aminopentyl)piperazin-1-yl]-5-bromo-1H-pyrimidin-6-one |
| SMILES | NCCCCCN1CCN(c2nc[nH]c(=O)c2Br)CC1 |
| InChI | InChI=1S/C13H22BrN5O/c14-11-12(16-10-17-13(11)20)19-8-6-18(7-9-19)5-3-1-2-4-15/h10H,1-9,15H2,(H,16,17,20) |
| InChIKey | FSZYRHRWSRGOEI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|