C15H27N5O — CID 136972852
4-[4-(1-aminopentan-2-yl)piperazin-1-yl]-2-ethyl-1H-pyrimidin-6-one (PubChem CID 136972852) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[4-(1-aminopentan-2-yl)piperazin-1-yl]-2-ethyl-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(1-aminopentan-2-yl)piperazin-1-yl]-2-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136972852 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 4-[4-(1-aminopentan-2-yl)piperazin-1-yl]-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCCC(CN)N1CCN(c2cc(=O)[nH]c(CC)n2)CC1 |
| InChI | InChI=1S/C15H27N5O/c1-3-5-12(11-16)19-6-8-20(9-7-19)14-10-15(21)18-13(4-2)17-14/h10,12H,3-9,11,16H2,1-2H3,(H,17,18,21) |
| InChIKey | PCHFPTHLJWQBBO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |