C12H17N5O — CID 136973037
2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanenitrile (PubChem CID 136973037) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 136973037 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[4-(2-methyl-6-oxo-1H-pyrimidin-4-yl)piperazin-1-yl]propanenitrile |
| SMILES | Cc1nc(N2CCN(C(C)C#N)CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O/c1-9(8-13)16-3-5-17(6-4-16)11-7-12(18)15-10(2)14-11/h7,9H,3-6H2,1-2H3,(H,14,15,18) |
| InChIKey | KPYSEDCHXOBGHJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |