C14H16N4O2S — CID 136973109
3-(N-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)anilino)propanethioamide (PubChem CID 136973109) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-(N-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)anilino)propanethioamide.
| Compound Name | 3-(N-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)anilino)propanethioamide |
|---|---|
| PubChem CID | 136973109 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-(N-(5-methoxy-6-oxo-1H-pyrimidin-4-yl)anilino)propanethioamide |
| SMILES | COc1c(N(CCC(N)=S)c2ccccc2)nc[nH]c1=O |
| InChI | InChI=1S/C14H16N4O2S/c1-20-12-13(16-9-17-14(12)19)18(8-7-11(15)21)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,15,21)(H,16,17,19) |
| InChIKey | YAPLYZYSFLZAQO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|