C12H11BrN4OS — CID 136973199
3-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarbothioamide (PubChem CID 136973199) has the molecular formula C12H11BrN4OS and a molecular weight of 339.22 g/mol. Its IUPAC name is 3-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarbothioamide.
| Compound Name | 3-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 136973199 |
| Molecular Formula | C12H11BrN4OS |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 3-[(5-bromo-6-oxo-1H-pyrimidin-4-yl)-methylamino]benzenecarbothioamide |
| SMILES | CN(c1cccc(C(N)=S)c1)c1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C12H11BrN4OS/c1-17(11-9(13)12(18)16-6-15-11)8-4-2-3-7(5-8)10(14)19/h2-6H,1H3,(H2,14,19)(H,15,16,18) |
| InChIKey | WYUYBZBDDGOUCQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|