C13H22N4O — CID 136973398
4-(3,5-dimethylpiperazin-1-yl)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136973398) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperazin-1-yl)-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(3,5-dimethylpiperazin-1-yl)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136973398 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-(3,5-dimethylpiperazin-1-yl)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC1CN(c2cc(=O)[nH]c(C(C)C)n2)CC(C)N1 |
| InChI | InChI=1S/C13H22N4O/c1-8(2)13-15-11(5-12(18)16-13)17-6-9(3)14-10(4)7-17/h5,8-10,14H,6-7H2,1-4H3,(H,15,16,18) |
| InChIKey | XWXSOAVJNMODDE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |